C11H13NO2 — CID 23618500
6-methyl-3,5,7,8-tetrahydrodioxolo[3,4-g]isoquinoline (PubChem CID 23618500) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 6-methyl-3,5,7,8-tetrahydrodioxolo[3,4-g]isoquinoline.
| Compound Name | 6-methyl-3,5,7,8-tetrahydrodioxolo[3,4-g]isoquinoline |
|---|---|
| PubChem CID | 23618500 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 6-methyl-3,5,7,8-tetrahydrodioxolo[3,4-g]isoquinoline |
| SMILES | CN1CCc2cc3c(cc2C1)COO3 |
| InChI | InChI=1S/C11H13NO2/c1-12-3-2-8-5-11-10(7-13-14-11)4-9(8)6-12/h4-5H,2-3,6-7H2,1H3 |
| InChIKey | FUEVXDSAWVRASL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|