About 7-amino-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol
7-amino-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol (PubChem CID 84656604) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is 7-amino-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol.
Molecular Properties
| Compound Name | 7-amino-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol |
| PubChem CID | 84656604 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 7-amino-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol |
| SMILES | CN1CCc2cc(O)c(N)cc2C1 |
| InChI | InChI=1S/C10H14N2O/c1-12-3-2-7-5-10(13)9(11)4-8(7)6-12/h4-5,13H,2-3,6,11H2,1H3 |
| InChIKey | UPYXOJPXUBJIJA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol?
The IUPAC name of 7-amino-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol (CID 84656604) is 7-amino-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol.
What is the SMILES notation for 7-amino-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol?
The canonical SMILES for 7-amino-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol is CN1CCc2cc(O)c(N)cc2C1.
What is the InChIKey of 7-amino-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol?
The InChIKey is UPYXOJPXUBJIJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c1-12-3-2-7-5-10(13)9(11)4-8(7)6-12/h4-5,13H,2-3,6,11H2,1H3.
What are the key properties of 7-amino-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol?
7-amino-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol has a molecular weight of 178.23 g/mol, XLogP of 0.96, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol is sourced from PubChem (CID 84656604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).