C10H14N2O — CID 84656604
7-amino-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol (PubChem CID 84656604) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 7-amino-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol.
| Compound Name | 7-amino-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol |
|---|---|
| PubChem CID | 84656604 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 7-amino-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol |
| SMILES | CN1CCc2cc(O)c(N)cc2C1 |
| InChI | InChI=1S/C10H14N2O/c1-12-3-2-7-5-10(13)9(11)4-8(7)6-12/h4-5,13H,2-3,6,11H2,1H3 |
| InChIKey | UPYXOJPXUBJIJA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|