C18H14ClNO3 — CID 68916394
3-(3-chlorophenyl)-1-(6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-yn-1-one (PubChem CID 68916394) has the molecular formula C18H14ClNO3 and a molecular weight of 327.77 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-(6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-yn-1-one.
| Compound Name | 3-(3-chlorophenyl)-1-(6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-yn-1-one |
|---|---|
| PubChem CID | 68916394 |
| Molecular Formula | C18H14ClNO3 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 3-(3-chlorophenyl)-1-(6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-yn-1-one |
| SMILES | O=C(C#Cc1cccc(Cl)c1)N1CCc2cc(O)c(O)cc2C1 |
| InChI | InChI=1S/C18H14ClNO3/c19-15-3-1-2-12(8-15)4-5-18(23)20-7-6-13-9-16(21)17(22)10-14(13)11-20/h1-3,8-10,21-22H,6-7,11H2 |
| InChIKey | HNTQQWSXMAVWHK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|