C10H9ClO2 — CID 131529370
6-chloro-7-hydroxy-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 131529370) has the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. Its IUPAC name is 6-chloro-7-hydroxy-3,4-dihydro-1H-naphthalen-2-one.
| Compound Name | 6-chloro-7-hydroxy-3,4-dihydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 131529370 |
| Molecular Formula | C10H9ClO2 |
| Molecular Weight | 196.63 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 6-chloro-7-hydroxy-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | O=C1CCc2cc(Cl)c(O)cc2C1 |
| InChI | InChI=1S/C10H9ClO2/c11-9-4-6-1-2-8(12)3-7(6)5-10(9)13/h4-5,13H,1-3H2 |
| InChIKey | WFCYPHSMISJPII-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.63 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |