About 5-chloro-7-hydroxy-2,3-dihydroinden-1-one
5-chloro-7-hydroxy-2,3-dihydroinden-1-one (PubChem CID 127255743) has the molecular formula C9H7ClO2
and a molecular weight of 182.61 g/mol. Its IUPAC name is 5-chloro-7-hydroxy-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 5-chloro-7-hydroxy-2,3-dihydroinden-1-one |
| PubChem CID | 127255743 |
| Molecular Formula | C9H7ClO2 |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | 5-chloro-7-hydroxy-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2cc(Cl)cc(O)c21 |
| InChI | InChI=1S/C9H7ClO2/c10-6-3-5-1-2-7(11)9(5)8(12)4-6/h3-4,12H,1-2H2 |
| InChIKey | SPHSTHMDYUGVKJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-7-hydroxy-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-7-hydroxy-2,3-dihydroinden-1-one?
The IUPAC name of 5-chloro-7-hydroxy-2,3-dihydroinden-1-one (CID 127255743) is 5-chloro-7-hydroxy-2,3-dihydroinden-1-one.
What is the SMILES notation for 5-chloro-7-hydroxy-2,3-dihydroinden-1-one?
The canonical SMILES for 5-chloro-7-hydroxy-2,3-dihydroinden-1-one is O=C1CCc2cc(Cl)cc(O)c21.
What is the InChIKey of 5-chloro-7-hydroxy-2,3-dihydroinden-1-one?
The InChIKey is SPHSTHMDYUGVKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClO2/c10-6-3-5-1-2-7(11)9(5)8(12)4-6/h3-4,12H,1-2H2.
What are the key properties of 5-chloro-7-hydroxy-2,3-dihydroinden-1-one?
5-chloro-7-hydroxy-2,3-dihydroinden-1-one has a molecular weight of 182.61 g/mol, XLogP of 2.17, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-7-hydroxy-2,3-dihydroinden-1-one is sourced from PubChem (CID 127255743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).