C9H7ClO2 — CID 127255743
5-chloro-7-hydroxy-2,3-dihydroinden-1-one (PubChem CID 127255743) has the molecular formula C9H7ClO2 and a molecular weight of 182.61 g/mol. Its IUPAC name is 5-chloro-7-hydroxy-2,3-dihydroinden-1-one.
| Compound Name | 5-chloro-7-hydroxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 127255743 |
| Molecular Formula | C9H7ClO2 |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | 5-chloro-7-hydroxy-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2cc(Cl)cc(O)c21 |
| InChI | InChI=1S/C9H7ClO2/c10-6-3-5-1-2-7(11)9(5)8(12)4-6/h3-4,12H,1-2H2 |
| InChIKey | SPHSTHMDYUGVKJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |