C10H10AlCl3O2 — CID 158655630
5-hydroxy-6-methyl-2,3-dihydroinden-1-one;trichloroalumane (PubChem CID 158655630) has the molecular formula C10H10AlCl3O2 and a molecular weight of 295.53 g/mol. Its IUPAC name is 5-hydroxy-6-methyl-2,3-dihydroinden-1-one;trichloroalumane.
| Compound Name | 5-hydroxy-6-methyl-2,3-dihydroinden-1-one;trichloroalumane |
|---|---|
| PubChem CID | 158655630 |
| Molecular Formula | C10H10AlCl3O2 |
| Molecular Weight | 295.53 g/mol |
| Exact Mass | 293.96 |
| IUPAC Name | 5-hydroxy-6-methyl-2,3-dihydroinden-1-one;trichloroalumane |
| SMILES | Cc1cc2c(cc1O)CCC2=O.Cl[Al](Cl)Cl |
| InChI | InChI=1S/C10H10O2.Al.3ClH/c1-6-4-8-7(5-10(6)12)2-3-9(8)11;;;;/h4-5,12H,2-3H2,1H3;;3*1H/q;+3;;;/p-3 |
| InChIKey | ICCFOJWWMAZLJK-UHFFFAOYSA-K |
| XLogP | 3.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |