C18H20O — CID 91171683
ethane;5-methyl-6-phenyl-2,3-dihydroinden-1-one (PubChem CID 91171683) has the molecular formula C18H20O and a molecular weight of 252.36 g/mol. Its IUPAC name is ethane;5-methyl-6-phenyl-2,3-dihydroinden-1-one.
| Compound Name | ethane;5-methyl-6-phenyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 91171683 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | ethane;5-methyl-6-phenyl-2,3-dihydroinden-1-one |
| SMILES | CC.Cc1cc2c(cc1-c1ccccc1)C(=O)CC2 |
| InChI | InChI=1S/C16H14O.C2H6/c1-11-9-13-7-8-16(17)15(13)10-14(11)12-5-3-2-4-6-12;1-2/h2-6,9-10H,7-8H2,1H3;1-2H3 |
| InChIKey | ZSBYIEJBEUPMEL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |