C20H16O — CID 174638646
5-phenyl-3,4-dihydro-2H-anthracen-1-one (PubChem CID 174638646) has the molecular formula C20H16O and a molecular weight of 272.35 g/mol. Its IUPAC name is 5-phenyl-3,4-dihydro-2H-anthracen-1-one.
| Compound Name | 5-phenyl-3,4-dihydro-2H-anthracen-1-one |
|---|---|
| PubChem CID | 174638646 |
| Molecular Formula | C20H16O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 5-phenyl-3,4-dihydro-2H-anthracen-1-one |
| SMILES | O=C1CCCc2cc3c(-c4ccccc4)cccc3cc21 |
| InChI | InChI=1S/C20H16O/c21-20-11-5-9-16-12-18-15(13-19(16)20)8-4-10-17(18)14-6-2-1-3-7-14/h1-4,6-8,10,12-13H,5,9,11H2 |
| InChIKey | BFQMEVBWOUZCOK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |