C20H18O — CID 125464395
6-ethyl-10,11-dihydro-9H-benzo[a]anthracen-8-one (PubChem CID 125464395) has the molecular formula C20H18O and a molecular weight of 274.36 g/mol. Its IUPAC name is 6-ethyl-10,11-dihydro-9H-benzo[a]anthracen-8-one.
| Compound Name | 6-ethyl-10,11-dihydro-9H-benzo[a]anthracen-8-one |
|---|---|
| PubChem CID | 125464395 |
| Molecular Formula | C20H18O |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 6-ethyl-10,11-dihydro-9H-benzo[a]anthracen-8-one |
| SMILES | CCc1cc2ccccc2c2cc3c(cc12)C(=O)CCC3 |
| InChI | InChI=1S/C20H18O/c1-2-13-10-14-6-3-4-8-16(14)19-11-15-7-5-9-20(21)18(15)12-17(13)19/h3-4,6,8,10-12H,2,5,7,9H2,1H3 |
| InChIKey | CRGWZNHWQYANPV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|