C18H20O — CID 174650762
5-tert-butyl-3,4-dihydro-2H-anthracen-1-one (PubChem CID 174650762) has the molecular formula C18H20O and a molecular weight of 252.36 g/mol. Its IUPAC name is 5-tert-butyl-3,4-dihydro-2H-anthracen-1-one.
| Compound Name | 5-tert-butyl-3,4-dihydro-2H-anthracen-1-one |
|---|---|
| PubChem CID | 174650762 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 5-tert-butyl-3,4-dihydro-2H-anthracen-1-one |
| SMILES | CC(C)(C)c1cccc2cc3c(cc12)CCCC3=O |
| InChI | InChI=1S/C18H20O/c1-18(2,3)16-8-4-6-12-11-15-13(10-14(12)16)7-5-9-17(15)19/h4,6,8,10-11H,5,7,9H2,1-3H3 |
| InChIKey | VCPDPAORJDRSPZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |