C14H11ClO — CID 174638642
7-chloro-3,4-dihydro-2H-anthracen-1-one (PubChem CID 174638642) has the molecular formula C14H11ClO and a molecular weight of 230.69 g/mol. Its IUPAC name is 7-chloro-3,4-dihydro-2H-anthracen-1-one.
| Compound Name | 7-chloro-3,4-dihydro-2H-anthracen-1-one |
|---|---|
| PubChem CID | 174638642 |
| Molecular Formula | C14H11ClO |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 7-chloro-3,4-dihydro-2H-anthracen-1-one |
| SMILES | O=C1CCCc2cc3ccc(Cl)cc3cc21 |
| InChI | InChI=1S/C14H11ClO/c15-12-5-4-9-6-10-2-1-3-14(16)13(10)8-11(9)7-12/h4-8H,1-3H2 |
| InChIKey | XDJPFRSWKMMEGJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |