C15H12Cl2 — CID 46177135
5,13-dichlorotricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene (PubChem CID 46177135) has the molecular formula C15H12Cl2 and a molecular weight of 263.17 g/mol. Its IUPAC name is 5,13-dichlorotricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene.
| Compound Name | 5,13-dichlorotricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene |
|---|---|
| PubChem CID | 46177135 |
| Molecular Formula | C15H12Cl2 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 5,13-dichlorotricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene |
| SMILES | Clc1ccc2c(c1)CCCc1cc(Cl)ccc1-2 |
| InChI | InChI=1S/C15H12Cl2/c16-12-4-6-14-10(8-12)2-1-3-11-9-13(17)5-7-15(11)14/h4-9H,1-3H2 |
| InChIKey | GMARHBMENSLLJF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |