C10H7ClNS- — CID 143868151
5-chloro-1-sulfido-2,3-dihydronaphtho[1,2-b]azirine (PubChem CID 143868151) has the molecular formula C10H7ClNS- and a molecular weight of 208.69 g/mol. Its IUPAC name is 5-chloro-1-sulfido-2,3-dihydronaphtho[1,2-b]azirine.
| Compound Name | 5-chloro-1-sulfido-2,3-dihydronaphtho[1,2-b]azirine |
|---|---|
| PubChem CID | 143868151 |
| Molecular Formula | C10H7ClNS- |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.00 |
| IUPAC Name | 5-chloro-1-sulfido-2,3-dihydronaphtho[1,2-b]azirine |
| SMILES | [S-]N1C2=C1c1ccc(Cl)cc1CC2 |
| InChI | InChI=1S/C10H7ClNS/c11-7-2-3-8-6(5-7)1-4-9-10(8)12(9)13/h2-3,5H,1,4H2/q-1 |
| InChIKey | JYMHHVHRTFEUJP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|