C13H12Cl3N — CID 123235689
1,8-dichloro-3-(chloromethyl)-4-methyl-5,6-dihydro-2-benzazocine (PubChem CID 123235689) has the molecular formula C13H12Cl3N and a molecular weight of 288.61 g/mol. Its IUPAC name is 1,8-dichloro-3-(chloromethyl)-4-methyl-5,6-dihydro-2-benzazocine.
| Compound Name | 1,8-dichloro-3-(chloromethyl)-4-methyl-5,6-dihydro-2-benzazocine |
|---|---|
| PubChem CID | 123235689 |
| Molecular Formula | C13H12Cl3N |
| Molecular Weight | 288.61 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 1,8-dichloro-3-(chloromethyl)-4-methyl-5,6-dihydro-2-benzazocine |
| SMILES | CC1=C(CCl)/N=C(/Cl)c2ccc(Cl)cc2CC1 |
| InChI | InChI=1S/C13H12Cl3N/c1-8-2-3-9-6-10(15)4-5-11(9)13(16)17-12(8)7-14/h4-6H,2-3,7H2,1H3/b12-8?,17-13+ |
| InChIKey | GDMFUHNCTYYWOR-HTBOCZJLSA-N |
| XLogP | 4.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|