C18H27Cl2NO — CID 142251758
2-chloroethanimine;2-chloro-7-methyl-8,9-dihydrobenzo[7]annulen-5-one;ethane (PubChem CID 142251758) has the molecular formula C18H27Cl2NO and a molecular weight of 344.33 g/mol. Its IUPAC name is 2-chloroethanimine;2-chloro-7-methyl-8,9-dihydrobenzo[7]annulen-5-one;ethane.
| Compound Name | 2-chloroethanimine;2-chloro-7-methyl-8,9-dihydrobenzo[7]annulen-5-one;ethane |
|---|---|
| PubChem CID | 142251758 |
| Molecular Formula | C18H27Cl2NO |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-chloroethanimine;2-chloro-7-methyl-8,9-dihydrobenzo[7]annulen-5-one;ethane |
| SMILES | CC.CC.CC1=CC(=O)c2ccc(Cl)cc2CC1.[H]/N=C/CCl |
| InChI | InChI=1S/C12H11ClO.C2H4ClN.2C2H6/c1-8-2-3-9-7-10(13)4-5-11(9)12(14)6-8;3-1-2-4;2*1-2/h4-7H,2-3H2,1H3;2,4H,1H2;2*1-2H3/b;4-2+;; |
| InChIKey | KTTXHIZSDZTGHN-COTLNTOLSA-N |
| XLogP | 6.34 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|