C14H15NO — CID 142252038
7-(3-iminopropyl)-8,9-dihydrobenzo[7]annulen-5-one (PubChem CID 142252038) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is 7-(3-iminopropyl)-8,9-dihydrobenzo[7]annulen-5-one.
| Compound Name | 7-(3-iminopropyl)-8,9-dihydrobenzo[7]annulen-5-one |
|---|---|
| PubChem CID | 142252038 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 7-(3-iminopropyl)-8,9-dihydrobenzo[7]annulen-5-one |
| SMILES | [H]/N=C/CCC1=CC(=O)c2ccccc2CC1 |
| InChI | InChI=1S/C14H15NO/c15-9-3-4-11-7-8-12-5-1-2-6-13(12)14(16)10-11/h1-2,5-6,9-10,15H,3-4,7-8H2/b15-9+ |
| InChIKey | IWANJGNJUYAVOR-OQLLNIDSSA-N |
| XLogP | 3.17 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|