C12H12O — CID 25023067
7-methyl-8,9-dihydrobenzo[7]annulen-5-one (PubChem CID 25023067) has the molecular formula C12H12O and a molecular weight of 172.23 g/mol. Its IUPAC name is 7-methyl-8,9-dihydrobenzo[7]annulen-5-one.
| Compound Name | 7-methyl-8,9-dihydrobenzo[7]annulen-5-one |
|---|---|
| PubChem CID | 25023067 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 7-methyl-8,9-dihydrobenzo[7]annulen-5-one |
| SMILES | CC1=CC(=O)c2ccccc2CC1 |
| InChI | InChI=1S/C12H12O/c1-9-6-7-10-4-2-3-5-11(10)12(13)8-9/h2-5,8H,6-7H2,1H3 |
| InChIKey | JTLFBUDEJBHHHS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |