C11H11Br — CID 12009186
4-bromo-3-methyl-1,2-dihydronaphthalene (PubChem CID 12009186) has the molecular formula C11H11Br and a molecular weight of 223.11 g/mol. Its IUPAC name is 4-bromo-3-methyl-1,2-dihydronaphthalene.
| Compound Name | 4-bromo-3-methyl-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 12009186 |
| Molecular Formula | C11H11Br |
| Molecular Weight | 223.11 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 4-bromo-3-methyl-1,2-dihydronaphthalene |
| SMILES | CC1=C(Br)c2ccccc2CC1 |
| InChI | InChI=1S/C11H11Br/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h2-5H,6-7H2,1H3 |
| InChIKey | PLAFUGVTTBNJCR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.11 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |