C14H11Br — CID 147917753
1-bromo-9,10-dihydrophenanthrene (PubChem CID 147917753) has the molecular formula C14H11Br and a molecular weight of 259.15 g/mol. Its IUPAC name is 1-bromo-9,10-dihydrophenanthrene.
| Compound Name | 1-bromo-9,10-dihydrophenanthrene |
|---|---|
| PubChem CID | 147917753 |
| Molecular Formula | C14H11Br |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 1-bromo-9,10-dihydrophenanthrene |
| SMILES | Brc1cccc2c1CCc1ccccc1-2 |
| InChI | InChI=1S/C14H11Br/c15-14-7-3-6-12-11-5-2-1-4-10(11)8-9-13(12)14/h1-7H,8-9H2 |
| InChIKey | IHJZUEXGGVXRNH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |