About 1-bromo-9,10-dihydrophenanthrene
1-bromo-9,10-dihydrophenanthrene (PubChem CID 147917753) has the molecular formula C14H11Br
and a molecular weight of 259.15 g/mol. Its IUPAC name is 1-bromo-9,10-dihydrophenanthrene.
Molecular Properties
| Compound Name | 1-bromo-9,10-dihydrophenanthrene |
| PubChem CID | 147917753 |
| Molecular Formula | C14H11Br |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 1-bromo-9,10-dihydrophenanthrene |
| SMILES | Brc1cccc2c1CCc1ccccc1-2 |
| InChI | InChI=1S/C14H11Br/c15-14-7-3-6-12-11-5-2-1-4-10(11)8-9-13(12)14/h1-7H,8-9H2 |
| InChIKey | IHJZUEXGGVXRNH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-9,10-dihydrophenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-9,10-dihydrophenanthrene?
The IUPAC name of 1-bromo-9,10-dihydrophenanthrene (CID 147917753) is 1-bromo-9,10-dihydrophenanthrene.
What is the SMILES notation for 1-bromo-9,10-dihydrophenanthrene?
The canonical SMILES for 1-bromo-9,10-dihydrophenanthrene is Brc1cccc2c1CCc1ccccc1-2.
What is the InChIKey of 1-bromo-9,10-dihydrophenanthrene?
The InChIKey is IHJZUEXGGVXRNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11Br/c15-14-7-3-6-12-11-5-2-1-4-10(11)8-9-13(12)14/h1-7H,8-9H2.
What are the key properties of 1-bromo-9,10-dihydrophenanthrene?
1-bromo-9,10-dihydrophenanthrene has a molecular weight of 259.15 g/mol, XLogP of 4.21, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-9,10-dihydrophenanthrene is sourced from PubChem (CID 147917753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).