C11H11KO — CID 23704656
potassium 2-methyl-3,4-dihydronaphthalen-1-olate (PubChem CID 23704656) has the molecular formula C11H11KO and a molecular weight of 198.31 g/mol. Its IUPAC name is potassium 2-methyl-3,4-dihydronaphthalen-1-olate.
| Compound Name | potassium 2-methyl-3,4-dihydronaphthalen-1-olate |
|---|---|
| PubChem CID | 23704656 |
| Molecular Formula | C11H11KO |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | potassium 2-methyl-3,4-dihydronaphthalen-1-olate |
| SMILES | CC1=C([O-])c2ccccc2CC1.[K+] |
| InChI | InChI=1S/C11H12O.K/c1-8-6-7-9-4-2-3-5-10(9)11(8)12;/h2-5,12H,6-7H2,1H3;/q;+1/p-1 |
| InChIKey | HRSOVJZBCCJELQ-UHFFFAOYSA-M |
| XLogP | -1.27 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |