C36H30F2N2NiO2 — CID 139204046
bis(2-[N-(4-fluorophenyl)-C-methylcarbonimidoyl]-3,4-dihydronaphthalen-1-olate);nickel(2+) (PubChem CID 139204046) has the molecular formula C36H30F2N2NiO2 and a molecular weight of 619.34 g/mol. Its IUPAC name is bis(2-[N-(4-fluorophenyl)-C-methylcarbonimidoyl]-3,4-dihydronaphthalen-1-olate);nickel(2+).
| Compound Name | bis(2-[N-(4-fluorophenyl)-C-methylcarbonimidoyl]-3,4-dihydronaphthalen-1-olate);nickel(2+) |
|---|---|
| PubChem CID | 139204046 |
| Molecular Formula | C36H30F2N2NiO2 |
| Molecular Weight | 619.34 g/mol |
| Exact Mass | 618.16 |
| IUPAC Name | bis(2-[N-(4-fluorophenyl)-C-methylcarbonimidoyl]-3,4-dihydronaphthalen-1-olate);nickel(2+) |
| SMILES | C/C(=N\c1ccc(F)cc1)C1=C([O-])c2ccccc2CC1.C/C(=N\c1ccc(F)cc1)C1=C([O-])c2ccccc2CC1.[Ni+2] |
| InChI | InChI=1S/2C18H16FNO.Ni/c2*1-12(20-15-9-7-14(19)8-10-15)16-11-6-13-4-2-3-5-17(13)18(16)21;/h2*2-5,7-10,21H,6,11H2,1H3;/q;;+2/p-2/b2*20-12+; |
| InChIKey | XWHPOLYVOATUSN-KJIDPWMZSA-L |
| XLogP | 7.27 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.34 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|