C38H30F6N2NiO2 — CID 139204042
bis(2-[C-methyl-N-[4-(trifluoromethyl)phenyl]carbonimidoyl]-3,4-dihydronaphthalen-1-olate);nickel(2+) (PubChem CID 139204042) has the molecular formula C38H30F6N2NiO2 and a molecular weight of 719.35 g/mol. Its IUPAC name is bis(2-[C-methyl-N-[4-(trifluoromethyl)phenyl]carbonimidoyl]-3,4-dihydronaphthalen-1-olate);nickel(2+).
| Compound Name | bis(2-[C-methyl-N-[4-(trifluoromethyl)phenyl]carbonimidoyl]-3,4-dihydronaphthalen-1-olate);nickel(2+) |
|---|---|
| PubChem CID | 139204042 |
| Molecular Formula | C38H30F6N2NiO2 |
| Molecular Weight | 719.35 g/mol |
| Exact Mass | 718.16 |
| IUPAC Name | bis(2-[C-methyl-N-[4-(trifluoromethyl)phenyl]carbonimidoyl]-3,4-dihydronaphthalen-1-olate);nickel(2+) |
| SMILES | C/C(=N\c1ccc(C(F)(F)F)cc1)C1=C([O-])c2ccccc2CC1.C/C(=N\c1ccc(C(F)(F)F)cc1)C1=C([O-])c2ccccc2CC1.[Ni+2] |
| InChI | InChI=1S/2C19H16F3NO.Ni/c2*1-12(23-15-9-7-14(8-10-15)19(20,21)22)16-11-6-13-4-2-3-5-17(13)18(16)24;/h2*2-5,7-10,24H,6,11H2,1H3;/q;;+2/p-2/b2*23-12+; |
| InChIKey | QFAXVMNCOQUREW-DJFKQLQMSA-L |
| XLogP | 9.03 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.35 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|