C21H24 — CID 144810375
4-(2-butan-2-ylphenyl)-3-methyl-1,2-dihydronaphthalene (PubChem CID 144810375) has the molecular formula C21H24 and a molecular weight of 276.42 g/mol. Its IUPAC name is 4-(2-butan-2-ylphenyl)-3-methyl-1,2-dihydronaphthalene.
| Compound Name | 4-(2-butan-2-ylphenyl)-3-methyl-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 144810375 |
| Molecular Formula | C21H24 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 4-(2-butan-2-ylphenyl)-3-methyl-1,2-dihydronaphthalene |
| SMILES | CCC(C)c1ccccc1C1=C(C)CCc2ccccc21 |
| InChI | InChI=1S/C21H24/c1-4-15(2)18-10-7-8-12-20(18)21-16(3)13-14-17-9-5-6-11-19(17)21/h5-12,15H,4,13-14H2,1-3H3 |
| InChIKey | QXIHOPSFWSSRBT-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |