C14H20N2 — CID 144582436
2-(2-butan-2-ylphenyl)-1-methyl-4,5-dihydroimidazole (PubChem CID 144582436) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-(2-butan-2-ylphenyl)-1-methyl-4,5-dihydroimidazole.
| Compound Name | 2-(2-butan-2-ylphenyl)-1-methyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 144582436 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2-(2-butan-2-ylphenyl)-1-methyl-4,5-dihydroimidazole |
| SMILES | CCC(C)c1ccccc1C1=NCCN1C |
| InChI | InChI=1S/C14H20N2/c1-4-11(2)12-7-5-6-8-13(12)14-15-9-10-16(14)3/h5-8,11H,4,9-10H2,1-3H3 |
| InChIKey | YWPDXBKHHGFCHR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |