C12H14ClNO — CID 84624500
6-chloro-2-(ethylamino)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 84624500) has the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. Its IUPAC name is 6-chloro-2-(ethylamino)-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 6-chloro-2-(ethylamino)-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 84624500 |
| Molecular Formula | C12H14ClNO |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 6-chloro-2-(ethylamino)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CCNC1CCc2cc(Cl)ccc2C1=O |
| InChI | InChI=1S/C12H14ClNO/c1-2-14-11-6-3-8-7-9(13)4-5-10(8)12(11)15/h4-5,7,11,14H,2-3,6H2,1H3 |
| InChIKey | HDCUTYVQSUIFCP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |