C9H6BrClO — CID 177207093
(2R)-2-bromo-5-chloro-2,3-dihydroinden-1-one (PubChem CID 177207093) has the molecular formula C9H6BrClO and a molecular weight of 245.50 g/mol. Its IUPAC name is (2R)-2-bromo-5-chloro-2,3-dihydroinden-1-one.
| Compound Name | (2R)-2-bromo-5-chloro-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 177207093 |
| Molecular Formula | C9H6BrClO |
| Molecular Weight | 245.50 g/mol |
| Exact Mass | 243.93 |
| IUPAC Name | (2R)-2-bromo-5-chloro-2,3-dihydroinden-1-one |
| SMILES | O=C1c2ccc(Cl)cc2C[C@H]1Br |
| InChI | InChI=1S/C9H6BrClO/c10-8-4-5-3-6(11)1-2-7(5)9(8)12/h1-3,8H,4H2/t8-/m1/s1 |
| InChIKey | XNTGHLJYUJLXQE-MRVPVSSYSA-N |
| XLogP | 2.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|