C10H9BrO — CID 177205826
(2S)-2-bromo-5-methyl-2,3-dihydroinden-1-one (PubChem CID 177205826) has the molecular formula C10H9BrO and a molecular weight of 225.09 g/mol. Its IUPAC name is (2S)-2-bromo-5-methyl-2,3-dihydroinden-1-one.
| Compound Name | (2S)-2-bromo-5-methyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 177205826 |
| Molecular Formula | C10H9BrO |
| Molecular Weight | 225.09 g/mol |
| Exact Mass | 223.98 |
| IUPAC Name | (2S)-2-bromo-5-methyl-2,3-dihydroinden-1-one |
| SMILES | Cc1ccc2c(c1)C[C@H](Br)C2=O |
| InChI | InChI=1S/C10H9BrO/c1-6-2-3-8-7(4-6)5-9(11)10(8)12/h2-4,9H,5H2,1H3/t9-/m0/s1 |
| InChIKey | LUUMIYKKTVTWOO-VIFPVBQESA-N |
| XLogP | 2.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.09 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|