C12H13BrO — CID 82024141
2-bromo-6-propan-2-yl-2,3-dihydroinden-1-one (PubChem CID 82024141) has the molecular formula C12H13BrO and a molecular weight of 253.14 g/mol. Its IUPAC name is 2-bromo-6-propan-2-yl-2,3-dihydroinden-1-one.
| Compound Name | 2-bromo-6-propan-2-yl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 82024141 |
| Molecular Formula | C12H13BrO |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 2-bromo-6-propan-2-yl-2,3-dihydroinden-1-one |
| SMILES | CC(C)c1ccc2c(c1)C(=O)C(Br)C2 |
| InChI | InChI=1S/C12H13BrO/c1-7(2)8-3-4-9-6-11(13)12(14)10(9)5-8/h3-5,7,11H,6H2,1-2H3 |
| InChIKey | PLANHISVJAOWIM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|