C9H7BrO2 — CID 71600332
2-bromo-5-hydroxy-2,3-dihydroinden-1-one (PubChem CID 71600332) has the molecular formula C9H7BrO2 and a molecular weight of 227.06 g/mol. Its IUPAC name is 2-bromo-5-hydroxy-2,3-dihydroinden-1-one.
| Compound Name | 2-bromo-5-hydroxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 71600332 |
| Molecular Formula | C9H7BrO2 |
| Molecular Weight | 227.06 g/mol |
| Exact Mass | 225.96 |
| IUPAC Name | 2-bromo-5-hydroxy-2,3-dihydroinden-1-one |
| SMILES | O=C1c2ccc(O)cc2CC1Br |
| InChI | InChI=1S/C9H7BrO2/c10-8-4-5-3-6(11)1-2-7(5)9(8)12/h1-3,8,11H,4H2 |
| InChIKey | IAKHTBVDMSIMAF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.06 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|