C11H10BrClO — CID 82024126
6-bromo-3-chloro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one (PubChem CID 82024126) has the molecular formula C11H10BrClO and a molecular weight of 273.56 g/mol. Its IUPAC name is 6-bromo-3-chloro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one.
| Compound Name | 6-bromo-3-chloro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
|---|---|
| PubChem CID | 82024126 |
| Molecular Formula | C11H10BrClO |
| Molecular Weight | 273.56 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | 6-bromo-3-chloro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
| SMILES | O=C1c2cc(Cl)ccc2CCCC1Br |
| InChI | InChI=1S/C11H10BrClO/c12-10-3-1-2-7-4-5-8(13)6-9(7)11(10)14/h4-6,10H,1-3H2 |
| InChIKey | DYGSFNXYQWYEIJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|