C18H15ClO2 — CID 91239869
3-chloro-5-phenoxy-9,10-dihydro-8H-benzo[8]annulen-7-one (PubChem CID 91239869) has the molecular formula C18H15ClO2 and a molecular weight of 298.77 g/mol. Its IUPAC name is 3-chloro-5-phenoxy-9,10-dihydro-8H-benzo[8]annulen-7-one.
| Compound Name | 3-chloro-5-phenoxy-9,10-dihydro-8H-benzo[8]annulen-7-one |
|---|---|
| PubChem CID | 91239869 |
| Molecular Formula | C18H15ClO2 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 3-chloro-5-phenoxy-9,10-dihydro-8H-benzo[8]annulen-7-one |
| SMILES | O=C1C=C(Oc2ccccc2)c2cc(Cl)ccc2CCC1 |
| InChI | InChI=1S/C18H15ClO2/c19-14-10-9-13-5-4-6-15(20)12-18(17(13)11-14)21-16-7-2-1-3-8-16/h1-3,7-12H,4-6H2 |
| InChIKey | DRTNIBSFJZEPIT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |