C16H15NO — CID 134846318
(E)-N-phenoxy-3,4-dihydro-2H-naphthalen-1-imine (PubChem CID 134846318) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is (E)-N-phenoxy-3,4-dihydro-2H-naphthalen-1-imine.
| Compound Name | (E)-N-phenoxy-3,4-dihydro-2H-naphthalen-1-imine |
|---|---|
| PubChem CID | 134846318 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (E)-N-phenoxy-3,4-dihydro-2H-naphthalen-1-imine |
| SMILES | c1ccc(O/N=C2\CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C16H15NO/c1-2-9-14(10-3-1)18-17-16-12-6-8-13-7-4-5-11-15(13)16/h1-5,7,9-11H,6,8,12H2/b17-16+ |
| InChIKey | RCVQCDNUVSQHGX-WUKNDPDISA-N |
| XLogP | 3.81 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|