C24H21NO2 — CID 90797617
5-[3-(3-aminophenyl)phenoxy]-9,10-dihydro-8H-benzo[8]annulen-7-one (PubChem CID 90797617) has the molecular formula C24H21NO2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 5-[3-(3-aminophenyl)phenoxy]-9,10-dihydro-8H-benzo[8]annulen-7-one.
| Compound Name | 5-[3-(3-aminophenyl)phenoxy]-9,10-dihydro-8H-benzo[8]annulen-7-one |
|---|---|
| PubChem CID | 90797617 |
| Molecular Formula | C24H21NO2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 5-[3-(3-aminophenyl)phenoxy]-9,10-dihydro-8H-benzo[8]annulen-7-one |
| SMILES | Nc1cccc(-c2cccc(OC3=CC(=O)CCCc4ccccc43)c2)c1 |
| InChI | InChI=1S/C24H21NO2/c25-20-10-3-8-18(14-20)19-9-5-12-22(15-19)27-24-16-21(26)11-4-7-17-6-1-2-13-23(17)24/h1-3,5-6,8-10,12-16H,4,7,11,25H2 |
| InChIKey | JFLDXCCBCOOITF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|