About 3-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)aniline
3-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)aniline (PubChem CID 139501279) has the molecular formula C14H13N
and a molecular weight of 195.27 g/mol. Its IUPAC name is 3-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)aniline.
Molecular Properties
| Compound Name | 3-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)aniline |
| PubChem CID | 139501279 |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 3-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)aniline |
| SMILES | Nc1cccc(-c2cccc3c2CC3)c1 |
| InChI | InChI=1S/C14H13N/c15-12-5-1-4-11(9-12)13-6-2-3-10-7-8-14(10)13/h1-6,9H,7-8,15H2 |
| InChIKey | DJFCOHRNPCFNJK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)aniline?
The IUPAC name of 3-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)aniline (CID 139501279) is 3-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)aniline.
What is the SMILES notation for 3-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)aniline?
The canonical SMILES for 3-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)aniline is Nc1cccc(-c2cccc3c2CC3)c1.
What is the InChIKey of 3-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)aniline?
The InChIKey is DJFCOHRNPCFNJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N/c15-12-5-1-4-11(9-12)13-6-2-3-10-7-8-14(10)13/h1-6,9H,7-8,15H2.
What are the key properties of 3-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)aniline?
3-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)aniline has a molecular weight of 195.27 g/mol, XLogP of 3.03, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)aniline is sourced from PubChem (CID 139501279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).