C14H13N — CID 139501279
3-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)aniline (PubChem CID 139501279) has the molecular formula C14H13N and a molecular weight of 195.27 g/mol. Its IUPAC name is 3-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)aniline.
| Compound Name | 3-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)aniline |
|---|---|
| PubChem CID | 139501279 |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 3-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)aniline |
| SMILES | Nc1cccc(-c2cccc3c2CC3)c1 |
| InChI | InChI=1S/C14H13N/c15-12-5-1-4-11(9-12)13-6-2-3-10-7-8-14(10)13/h1-6,9H,7-8,15H2 |
| InChIKey | DJFCOHRNPCFNJK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|