C16H13ClO — CID 125481885
(2S)-2-benzyl-6-chloro-2,3-dihydroinden-1-one (PubChem CID 125481885) has the molecular formula C16H13ClO and a molecular weight of 256.73 g/mol. Its IUPAC name is (2S)-2-benzyl-6-chloro-2,3-dihydroinden-1-one.
| Compound Name | (2S)-2-benzyl-6-chloro-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 125481885 |
| Molecular Formula | C16H13ClO |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (2S)-2-benzyl-6-chloro-2,3-dihydroinden-1-one |
| SMILES | O=C1c2cc(Cl)ccc2C[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C16H13ClO/c17-14-7-6-12-9-13(16(18)15(12)10-14)8-11-4-2-1-3-5-11/h1-7,10,13H,8-9H2/t13-/m0/s1 |
| InChIKey | VTZPKJZMGARDFP-ZDUSSCGKSA-N |
| XLogP | 3.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |