C15H10Cl2O — CID 125481365
(2S)-6-chloro-2-(4-chlorophenyl)-2,3-dihydroinden-1-one (PubChem CID 125481365) has the molecular formula C15H10Cl2O and a molecular weight of 277.15 g/mol. Its IUPAC name is (2S)-6-chloro-2-(4-chlorophenyl)-2,3-dihydroinden-1-one.
| Compound Name | (2S)-6-chloro-2-(4-chlorophenyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 125481365 |
| Molecular Formula | C15H10Cl2O |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | (2S)-6-chloro-2-(4-chlorophenyl)-2,3-dihydroinden-1-one |
| SMILES | O=C1c2cc(Cl)ccc2C[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H10Cl2O/c16-11-4-1-9(2-5-11)13-7-10-3-6-12(17)8-14(10)15(13)18/h1-6,8,13H,7H2/t13-/m0/s1 |
| InChIKey | HFUJEYGUMLKUQR-ZDUSSCGKSA-N |
| XLogP | 4.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |