About (3S)-7-chloro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid
(3S)-7-chloro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid (PubChem CID 7464521) has the molecular formula C10H7ClO4
and a molecular weight of 226.61 g/mol. Its IUPAC name is (3S)-7-chloro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid.
Analyze (3S)-7-chloro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-7-chloro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid?
The IUPAC name of (3S)-7-chloro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid (CID 7464521) is (3S)-7-chloro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid.
What is the SMILES notation for (3S)-7-chloro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid?
The canonical SMILES for (3S)-7-chloro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid is O=C1O[C@H](C(=O)O)Cc2ccc(Cl)cc21.
What is the InChIKey of (3S)-7-chloro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid?
The InChIKey is UVKLQENEDYQPHW-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H7ClO4/c11-6-2-1-5-3-8(9(12)13)15-10(14)7(5)4-6/h1-2,4,8H,3H2,(H,12,13)/t8-/m0/s1.
What are the key properties of (3S)-7-chloro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid?
(3S)-7-chloro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid has a molecular weight of 226.61 g/mol, XLogP of 1.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-7-chloro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid is sourced from PubChem (CID 7464521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).