C26H19Cl — CID 144785467
(9S)-3-(4-chlorophenyl)-9-phenyl-9,10-dihydrophenanthrene (PubChem CID 144785467) has the molecular formula C26H19Cl and a molecular weight of 366.89 g/mol. Its IUPAC name is (9S)-3-(4-chlorophenyl)-9-phenyl-9,10-dihydrophenanthrene.
| Compound Name | (9S)-3-(4-chlorophenyl)-9-phenyl-9,10-dihydrophenanthrene |
|---|---|
| PubChem CID | 144785467 |
| Molecular Formula | C26H19Cl |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (9S)-3-(4-chlorophenyl)-9-phenyl-9,10-dihydrophenanthrene |
| SMILES | Clc1ccc(-c2ccc3c(c2)-c2ccccc2[C@H](c2ccccc2)C3)cc1 |
| InChI | InChI=1S/C26H19Cl/c27-22-14-12-18(13-15-22)20-10-11-21-17-25(19-6-2-1-3-7-19)23-8-4-5-9-24(23)26(21)16-20/h1-16,25H,17H2/t25-/m0/s1 |
| InChIKey | OBHKTRSAUMNQPH-VWLOTQADSA-N |
| XLogP | 7.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |