C16H14ClNO — CID 13272466
2-benzyl-6-chloro-1,3-dihydroisoquinolin-4-one (PubChem CID 13272466) has the molecular formula C16H14ClNO and a molecular weight of 271.75 g/mol. Its IUPAC name is 2-benzyl-6-chloro-1,3-dihydroisoquinolin-4-one.
| Compound Name | 2-benzyl-6-chloro-1,3-dihydroisoquinolin-4-one |
|---|---|
| PubChem CID | 13272466 |
| Molecular Formula | C16H14ClNO |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-benzyl-6-chloro-1,3-dihydroisoquinolin-4-one |
| SMILES | O=C1CN(Cc2ccccc2)Cc2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H14ClNO/c17-14-7-6-13-10-18(11-16(19)15(13)8-14)9-12-4-2-1-3-5-12/h1-8H,9-11H2 |
| InChIKey | ROWPRXGFODHMBU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |