C23H22ClN3O — CID 46389874
1-(2-benzyl-1,3-dihydroisoindol-5-yl)-3-(3-chloro-4-methylphenyl)urea (PubChem CID 46389874) has the molecular formula C23H22ClN3O and a molecular weight of 391.90 g/mol. Its IUPAC name is 1-(2-benzyl-1,3-dihydroisoindol-5-yl)-3-(3-chloro-4-methylphenyl)urea.
| Compound Name | 1-(2-benzyl-1,3-dihydroisoindol-5-yl)-3-(3-chloro-4-methylphenyl)urea |
|---|---|
| PubChem CID | 46389874 |
| Molecular Formula | C23H22ClN3O |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 1-(2-benzyl-1,3-dihydroisoindol-5-yl)-3-(3-chloro-4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc3c(c2)CN(Cc2ccccc2)C3)cc1Cl |
| InChI | InChI=1S/C23H22ClN3O/c1-16-7-9-21(12-22(16)24)26-23(28)25-20-10-8-18-14-27(15-19(18)11-20)13-17-5-3-2-4-6-17/h2-12H,13-15H2,1H3,(H2,25,26,28) |
| InChIKey | SVGOALPWNUNBRL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |