C22H20BrN3O — CID 46389889
1-(2-benzyl-1,3-dihydroisoindol-5-yl)-3-(3-bromophenyl)urea (PubChem CID 46389889) has the molecular formula C22H20BrN3O and a molecular weight of 422.33 g/mol. Its IUPAC name is 1-(2-benzyl-1,3-dihydroisoindol-5-yl)-3-(3-bromophenyl)urea.
| Compound Name | 1-(2-benzyl-1,3-dihydroisoindol-5-yl)-3-(3-bromophenyl)urea |
|---|---|
| PubChem CID | 46389889 |
| Molecular Formula | C22H20BrN3O |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 1-(2-benzyl-1,3-dihydroisoindol-5-yl)-3-(3-bromophenyl)urea |
| SMILES | O=C(Nc1cccc(Br)c1)Nc1ccc2c(c1)CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C22H20BrN3O/c23-19-7-4-8-20(12-19)24-22(27)25-21-10-9-17-14-26(15-18(17)11-21)13-16-5-2-1-3-6-16/h1-12H,13-15H2,(H2,24,25,27) |
| InChIKey | TXIBEHMMTFJJQB-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |