C24H25N3O — CID 46389876
1-(2-benzyl-1,3-dihydroisoindol-5-yl)-3-(2,5-dimethylphenyl)urea (PubChem CID 46389876) has the molecular formula C24H25N3O and a molecular weight of 371.48 g/mol. Its IUPAC name is 1-(2-benzyl-1,3-dihydroisoindol-5-yl)-3-(2,5-dimethylphenyl)urea.
| Compound Name | 1-(2-benzyl-1,3-dihydroisoindol-5-yl)-3-(2,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 46389876 |
| Molecular Formula | C24H25N3O |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 1-(2-benzyl-1,3-dihydroisoindol-5-yl)-3-(2,5-dimethylphenyl)urea |
| SMILES | Cc1ccc(C)c(NC(=O)Nc2ccc3c(c2)CN(Cc2ccccc2)C3)c1 |
| InChI | InChI=1S/C24H25N3O/c1-17-8-9-18(2)23(12-17)26-24(28)25-22-11-10-20-15-27(16-21(20)13-22)14-19-6-4-3-5-7-19/h3-13H,14-16H2,1-2H3,(H2,25,26,28) |
| InChIKey | LFLPOMSHYOTASG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |