C25H24N4O2 — CID 46259435
1-(1-benzyl-3-methyl-2-oxoquinoxalin-6-yl)-3-(2,5-dimethylphenyl)urea (PubChem CID 46259435) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1-(1-benzyl-3-methyl-2-oxoquinoxalin-6-yl)-3-(2,5-dimethylphenyl)urea.
| Compound Name | 1-(1-benzyl-3-methyl-2-oxoquinoxalin-6-yl)-3-(2,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 46259435 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 1-(1-benzyl-3-methyl-2-oxoquinoxalin-6-yl)-3-(2,5-dimethylphenyl)urea |
| SMILES | Cc1ccc(C)c(NC(=O)Nc2ccc3c(c2)nc(C)c(=O)n3Cc2ccccc2)c1 |
| InChI | InChI=1S/C25H24N4O2/c1-16-9-10-17(2)21(13-16)28-25(31)27-20-11-12-23-22(14-20)26-18(3)24(30)29(23)15-19-7-5-4-6-8-19/h4-14H,15H2,1-3H3,(H2,27,28,31) |
| InChIKey | SDBGVUDTJSKXCH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |