C30H28N4O — CID 46382396
1-(2,5-dimethylphenyl)-3-[4-[2-(1-phenylbenzimidazol-2-yl)ethyl]phenyl]urea (PubChem CID 46382396) has the molecular formula C30H28N4O and a molecular weight of 460.58 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[4-[2-(1-phenylbenzimidazol-2-yl)ethyl]phenyl]urea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[4-[2-(1-phenylbenzimidazol-2-yl)ethyl]phenyl]urea |
|---|---|
| PubChem CID | 46382396 |
| Molecular Formula | C30H28N4O |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[4-[2-(1-phenylbenzimidazol-2-yl)ethyl]phenyl]urea |
| SMILES | Cc1ccc(C)c(NC(=O)Nc2ccc(CCc3nc4ccccc4n3-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C30H28N4O/c1-21-12-13-22(2)27(20-21)33-30(35)31-24-17-14-23(15-18-24)16-19-29-32-26-10-6-7-11-28(26)34(29)25-8-4-3-5-9-25/h3-15,17-18,20H,16,19H2,1-2H3,(H2,31,33,35) |
| InChIKey | VWJGNKAMUWAIHF-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |