C28H23ClN4O — CID 46382241
1-(3-chlorophenyl)-3-[3-[2-(1-phenylbenzimidazol-2-yl)ethyl]phenyl]urea (PubChem CID 46382241) has the molecular formula C28H23ClN4O and a molecular weight of 466.97 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[3-[2-(1-phenylbenzimidazol-2-yl)ethyl]phenyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[3-[2-(1-phenylbenzimidazol-2-yl)ethyl]phenyl]urea |
|---|---|
| PubChem CID | 46382241 |
| Molecular Formula | C28H23ClN4O |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[3-[2-(1-phenylbenzimidazol-2-yl)ethyl]phenyl]urea |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1cccc(CCc2nc3ccccc3n2-c2ccccc2)c1 |
| InChI | InChI=1S/C28H23ClN4O/c29-21-9-7-11-23(19-21)31-28(34)30-22-10-6-8-20(18-22)16-17-27-32-25-14-4-5-15-26(25)33(27)24-12-2-1-3-13-24/h1-15,18-19H,16-17H2,(H2,30,31,34) |
| InChIKey | MGDTWYRCLINUBM-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |