C29H24N4O3 — CID 46382231
1-(1,3-benzodioxol-5-yl)-3-[3-[2-(1-phenylbenzimidazol-2-yl)ethyl]phenyl]urea (PubChem CID 46382231) has the molecular formula C29H24N4O3 and a molecular weight of 476.54 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[3-[2-(1-phenylbenzimidazol-2-yl)ethyl]phenyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[3-[2-(1-phenylbenzimidazol-2-yl)ethyl]phenyl]urea |
|---|---|
| PubChem CID | 46382231 |
| Molecular Formula | C29H24N4O3 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[3-[2-(1-phenylbenzimidazol-2-yl)ethyl]phenyl]urea |
| SMILES | O=C(Nc1cccc(CCc2nc3ccccc3n2-c2ccccc2)c1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H24N4O3/c34-29(31-22-14-15-26-27(18-22)36-19-35-26)30-21-8-6-7-20(17-21)13-16-28-32-24-11-4-5-12-25(24)33(28)23-9-2-1-3-10-23/h1-12,14-15,17-18H,13,16,19H2,(H2,30,31,34) |
| InChIKey | QARGQVCPOABHGU-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |