C25H23N3O3 — CID 55524175
N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(1-phenylbenzimidazol-2-yl)propanamide (PubChem CID 55524175) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(1-phenylbenzimidazol-2-yl)propanamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(1-phenylbenzimidazol-2-yl)propanamide |
|---|---|
| PubChem CID | 55524175 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(1-phenylbenzimidazol-2-yl)propanamide |
| SMILES | CC(NC(=O)CCc1nc2ccccc2n1-c1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H23N3O3/c1-17(18-11-12-22-23(15-18)31-16-30-22)26-25(29)14-13-24-27-20-9-5-6-10-21(20)28(24)19-7-3-2-4-8-19/h2-12,15,17H,13-14,16H2,1H3,(H,26,29) |
| InChIKey | BCLBSBIRYFPWCF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |