C25H26N4O3S — CID 60512681
N-[1-[3-(methanesulfonamido)phenyl]ethyl]-3-(1-phenylbenzimidazol-2-yl)propanamide (PubChem CID 60512681) has the molecular formula C25H26N4O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is N-[1-[3-(methanesulfonamido)phenyl]ethyl]-3-(1-phenylbenzimidazol-2-yl)propanamide.
| Compound Name | N-[1-[3-(methanesulfonamido)phenyl]ethyl]-3-(1-phenylbenzimidazol-2-yl)propanamide |
|---|---|
| PubChem CID | 60512681 |
| Molecular Formula | C25H26N4O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | N-[1-[3-(methanesulfonamido)phenyl]ethyl]-3-(1-phenylbenzimidazol-2-yl)propanamide |
| SMILES | CC(NC(=O)CCc1nc2ccccc2n1-c1ccccc1)c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C25H26N4O3S/c1-18(19-9-8-10-20(17-19)28-33(2,31)32)26-25(30)16-15-24-27-22-13-6-7-14-23(22)29(24)21-11-4-3-5-12-21/h3-14,17-18,28H,15-16H2,1-2H3,(H,26,30) |
| InChIKey | FUMKTCDUZXGKAP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |