C21H21N3O3 — CID 18143612
N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(1-phenylpyrazol-4-yl)propanamide (PubChem CID 18143612) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(1-phenylpyrazol-4-yl)propanamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(1-phenylpyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 18143612 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(1-phenylpyrazol-4-yl)propanamide |
| SMILES | CC(NC(=O)CCc1cnn(-c2ccccc2)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H21N3O3/c1-15(17-8-9-19-20(11-17)27-14-26-19)23-21(25)10-7-16-12-22-24(13-16)18-5-3-2-4-6-18/h2-6,8-9,11-13,15H,7,10,14H2,1H3,(H,23,25) |
| InChIKey | OIIXBCIHSBSRDQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |