C24H21F3N4O — CID 46382209
1-[3-[2-(1-methylbenzimidazol-2-yl)ethyl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 46382209) has the molecular formula C24H21F3N4O and a molecular weight of 438.45 g/mol. Its IUPAC name is 1-[3-[2-(1-methylbenzimidazol-2-yl)ethyl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-[2-(1-methylbenzimidazol-2-yl)ethyl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 46382209 |
| Molecular Formula | C24H21F3N4O |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 1-[3-[2-(1-methylbenzimidazol-2-yl)ethyl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | Cn1c(CCc2cccc(NC(=O)Nc3cccc(C(F)(F)F)c3)c2)nc2ccccc21 |
| InChI | InChI=1S/C24H21F3N4O/c1-31-21-11-3-2-10-20(21)30-22(31)13-12-16-6-4-8-18(14-16)28-23(32)29-19-9-5-7-17(15-19)24(25,26)27/h2-11,14-15H,12-13H2,1H3,(H2,28,29,32) |
| InChIKey | XUQXAFDOEGKEGL-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |